C15H22F3NO2 — CID 61171276
2-(2-butoxyethylamino)-1-[3-(trifluoromethyl)phenyl]ethanol (PubChem CID 61171276) has the molecular formula C15H22F3NO2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-(2-butoxyethylamino)-1-[3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-(2-butoxyethylamino)-1-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 61171276 |
| Molecular Formula | C15H22F3NO2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-(2-butoxyethylamino)-1-[3-(trifluoromethyl)phenyl]ethanol |
| SMILES | CCCCOCCNCC(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H22F3NO2/c1-2-3-8-21-9-7-19-11-14(20)12-5-4-6-13(10-12)15(16,17)18/h4-6,10,14,19-20H,2-3,7-9,11H2,1H3 |
| InChIKey | YCDHKJNOHNOPJT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|