C14H20F3NO3 — CID 106309771
2-[3-(2-hydroxyethoxy)propylamino]-1-[3-(trifluoromethyl)phenyl]ethanol (PubChem CID 106309771) has the molecular formula C14H20F3NO3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethoxy)propylamino]-1-[3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-[3-(2-hydroxyethoxy)propylamino]-1-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 106309771 |
| Molecular Formula | C14H20F3NO3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-[3-(2-hydroxyethoxy)propylamino]-1-[3-(trifluoromethyl)phenyl]ethanol |
| SMILES | OCCOCCCNCC(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3NO3/c15-14(16,17)12-4-1-3-11(9-12)13(20)10-18-5-2-7-21-8-6-19/h1,3-4,9,13,18-20H,2,5-8,10H2 |
| InChIKey | AUXZGRQEHHTAQI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|