C20H22F3NO4 — CID 67790270
(2R)-2-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 67790270) has the molecular formula C20H22F3NO4 and a molecular weight of 397.39 g/mol. Its IUPAC name is (2R)-2-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | (2R)-2-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67790270 |
| Molecular Formula | C20H22F3NO4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (2R)-2-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | C[C@@H](C(=O)O)c1ccc(OCCNCC(O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H22F3NO4/c1-13(19(26)27)14-5-7-17(8-6-14)28-10-9-24-12-18(25)15-3-2-4-16(11-15)20(21,22)23/h2-8,11,13,18,24-25H,9-10,12H2,1H3,(H,26,27)/t13-,18?/m1/s1 |
| InChIKey | DNKVSEQNEFIQKT-YJJYDOSJSA-N |
| XLogP | 3.60 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|