C12H13F6NOS — CID 106429233
1-[3-(trifluoromethyl)phenyl]-2-[2-(trifluoromethylsulfanyl)ethylamino]ethanol (PubChem CID 106429233) has the molecular formula C12H13F6NOS and a molecular weight of 333.30 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]-2-[2-(trifluoromethylsulfanyl)ethylamino]ethanol.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]-2-[2-(trifluoromethylsulfanyl)ethylamino]ethanol |
|---|---|
| PubChem CID | 106429233 |
| Molecular Formula | C12H13F6NOS |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]-2-[2-(trifluoromethylsulfanyl)ethylamino]ethanol |
| SMILES | OC(CNCCSC(F)(F)F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F6NOS/c13-11(14,15)9-3-1-2-8(6-9)10(20)7-19-4-5-21-12(16,17)18/h1-3,6,10,19-20H,4-5,7H2 |
| InChIKey | GZLHUAWHUBGJJX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|