C14H13BrF3NOS — CID 60969473
2-[(4-bromothiophen-2-yl)methylamino]-1-[3-(trifluoromethyl)phenyl]ethanol (PubChem CID 60969473) has the molecular formula C14H13BrF3NOS and a molecular weight of 380.23 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methylamino]-1-[3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-[(4-bromothiophen-2-yl)methylamino]-1-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 60969473 |
| Molecular Formula | C14H13BrF3NOS |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methylamino]-1-[3-(trifluoromethyl)phenyl]ethanol |
| SMILES | OC(CNCc1cc(Br)cs1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13BrF3NOS/c15-11-5-12(21-8-11)6-19-7-13(20)9-2-1-3-10(4-9)14(16,17)18/h1-5,8,13,19-20H,6-7H2 |
| InChIKey | QZJKWBPGKZFVLK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |