C21H27F3N2O4S — CID 70467792
N-[2-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenoxy]ethyl]methanesulfonamide (PubChem CID 70467792) has the molecular formula C21H27F3N2O4S and a molecular weight of 460.52 g/mol. Its IUPAC name is N-[2-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenoxy]ethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 70467792 |
| Molecular Formula | C21H27F3N2O4S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-[2-[4-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenoxy]ethyl]methanesulfonamide |
| SMILES | CC(Cc1ccc(OCCNS(C)(=O)=O)cc1)NCC(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H27F3N2O4S/c1-15(25-14-20(27)17-4-3-5-18(13-17)21(22,23)24)12-16-6-8-19(9-7-16)30-11-10-26-31(2,28)29/h3-9,13,15,20,25-27H,10-12,14H2,1-2H3 |
| InChIKey | RKGWORIEQJTXNE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|