C19H23F3N2O — CID 70554567
2-[1-[4-(aminomethyl)phenyl]propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethanol (PubChem CID 70554567) has the molecular formula C19H23F3N2O and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-[1-[4-(aminomethyl)phenyl]propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-[1-[4-(aminomethyl)phenyl]propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 70554567 |
| Molecular Formula | C19H23F3N2O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-[1-[4-(aminomethyl)phenyl]propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethanol |
| SMILES | CC(Cc1ccc(CN)cc1)NCC(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H23F3N2O/c1-13(9-14-5-7-15(11-23)8-6-14)24-12-18(25)16-3-2-4-17(10-16)19(20,21)22/h2-8,10,13,18,24-25H,9,11-12,23H2,1H3 |
| InChIKey | SWETWHOCLOGGQD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |