C18H23Cl2F3N2O — CID 70534879
2-[1-(4-aminophenyl)propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethanol;dihydrochloride (PubChem CID 70534879) has the molecular formula C18H23Cl2F3N2O and a molecular weight of 411.30 g/mol. Its IUPAC name is 2-[1-(4-aminophenyl)propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethanol;dihydrochloride.
| Compound Name | 2-[1-(4-aminophenyl)propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 70534879 |
| Molecular Formula | C18H23Cl2F3N2O |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-[1-(4-aminophenyl)propan-2-ylamino]-1-[3-(trifluoromethyl)phenyl]ethanol;dihydrochloride |
| SMILES | CC(Cc1ccc(N)cc1)NCC(O)c1cccc(C(F)(F)F)c1.Cl.Cl |
| InChI | InChI=1S/C18H21F3N2O.2ClH/c1-12(9-13-5-7-16(22)8-6-13)23-11-17(24)14-3-2-4-15(10-14)18(19,20)21;;/h2-8,10,12,17,23-24H,9,11,22H2,1H3;2*1H |
| InChIKey | JLAOWOPMQTTWCJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|