C20H23F3N2O2 — CID 70430543
4-[(3R)-3-[[(2S)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzamide (PubChem CID 70430543) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 4-[(3R)-3-[[(2S)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzamide.
| Compound Name | 4-[(3R)-3-[[(2S)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzamide |
|---|---|
| PubChem CID | 70430543 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-[(3R)-3-[[(2S)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]benzamide |
| SMILES | C[C@H](CCc1ccc(C(N)=O)cc1)NC[C@@H](O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H23F3N2O2/c1-13(5-6-14-7-9-15(10-8-14)19(24)27)25-12-18(26)16-3-2-4-17(11-16)20(21,22)23/h2-4,7-11,13,18,25-26H,5-6,12H2,1H3,(H2,24,27)/t13-,18-/m1/s1 |
| InChIKey | NHOBVWACQYTTEJ-FZKQIMNGSA-N |
| XLogP | 3.45 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |