C21H24F3NO3S — CID 70430309
(E)-3-[5-[(3R)-3-[[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]thiophen-2-yl]but-2-enoic acid (PubChem CID 70430309) has the molecular formula C21H24F3NO3S and a molecular weight of 427.49 g/mol. Its IUPAC name is (E)-3-[5-[(3R)-3-[[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]thiophen-2-yl]but-2-enoic acid.
| Compound Name | (E)-3-[5-[(3R)-3-[[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]thiophen-2-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 70430309 |
| Molecular Formula | C21H24F3NO3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (E)-3-[5-[(3R)-3-[[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]butyl]thiophen-2-yl]but-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)c1ccc(CC[C@@H](C)NC[C@H](O)c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C21H24F3NO3S/c1-13(10-20(27)28)19-9-8-17(29-19)7-6-14(2)25-12-18(26)15-4-3-5-16(11-15)21(22,23)24/h3-5,8-11,14,18,25-26H,6-7,12H2,1-2H3,(H,27,28)/b13-10+/t14-,18+/m1/s1 |
| InChIKey | UVKNMQANHYCAJT-IUSOGQAPSA-N |
| XLogP | 4.90 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|