C22H24F3NO3 — CID 70551657
methyl 3-[2-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenyl]prop-2-enoate (PubChem CID 70551657) has the molecular formula C22H24F3NO3 and a molecular weight of 407.43 g/mol. Its IUPAC name is methyl 3-[2-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[2-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 70551657 |
| Molecular Formula | C22H24F3NO3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | methyl 3-[2-[2-[[2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]amino]propyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccccc1CC(C)NCC(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H24F3NO3/c1-15(12-17-7-4-3-6-16(17)10-11-21(28)29-2)26-14-20(27)18-8-5-9-19(13-18)22(23,24)25/h3-11,13,15,20,26-27H,12,14H2,1-2H3 |
| InChIKey | SZUXOCJKJSBXNZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|