C20H25Cl2NO3 — CID 44522674
methyl 4-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]butyl]benzoate;hydrochloride (PubChem CID 44522674) has the molecular formula C20H25Cl2NO3 and a molecular weight of 398.33 g/mol. Its IUPAC name is methyl 4-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]butyl]benzoate;hydrochloride.
| Compound Name | methyl 4-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]butyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 44522674 |
| Molecular Formula | C20H25Cl2NO3 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | methyl 4-[3-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]butyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(CCC(C)NCC(O)c2cccc(Cl)c2)cc1.Cl |
| InChI | InChI=1S/C20H24ClNO3.ClH/c1-14(22-13-19(23)17-4-3-5-18(21)12-17)6-7-15-8-10-16(11-9-15)20(24)25-2;/h3-5,8-12,14,19,22-23H,6-7,13H2,1-2H3;1H |
| InChIKey | XIKNBRUXLBCUOV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |