C19H22INO3 — CID 44522721
methyl 4-[2-[[2-hydroxy-2-(3-iodophenyl)ethyl]amino]propyl]benzoate (PubChem CID 44522721) has the molecular formula C19H22INO3 and a molecular weight of 439.29 g/mol. Its IUPAC name is methyl 4-[2-[[2-hydroxy-2-(3-iodophenyl)ethyl]amino]propyl]benzoate.
| Compound Name | methyl 4-[2-[[2-hydroxy-2-(3-iodophenyl)ethyl]amino]propyl]benzoate |
|---|---|
| PubChem CID | 44522721 |
| Molecular Formula | C19H22INO3 |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | methyl 4-[2-[[2-hydroxy-2-(3-iodophenyl)ethyl]amino]propyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(C)NCC(O)c2cccc(I)c2)cc1 |
| InChI | InChI=1S/C19H22INO3/c1-13(10-14-6-8-15(9-7-14)19(23)24-2)21-12-18(22)16-4-3-5-17(20)11-16/h3-9,11,13,18,21-22H,10,12H2,1-2H3 |
| InChIKey | SIBBJKDLPOEAMV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|