C21H23NO4 — CID 70545400
methyl 4-[2-[[(2R)-2-(2-benzofuran-1-yl)-2-hydroxyethyl]amino]propyl]benzoate (PubChem CID 70545400) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl 4-[2-[[(2R)-2-(2-benzofuran-1-yl)-2-hydroxyethyl]amino]propyl]benzoate.
| Compound Name | methyl 4-[2-[[(2R)-2-(2-benzofuran-1-yl)-2-hydroxyethyl]amino]propyl]benzoate |
|---|---|
| PubChem CID | 70545400 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | methyl 4-[2-[[(2R)-2-(2-benzofuran-1-yl)-2-hydroxyethyl]amino]propyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(C)NC[C@@H](O)c2occ3ccccc23)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-14(11-15-7-9-16(10-8-15)21(24)25-2)22-12-19(23)20-18-6-4-3-5-17(18)13-26-20/h3-10,13-14,19,22-23H,11-12H2,1-2H3/t14?,19-/m1/s1 |
| InChIKey | JQKMWKCBCSWVSD-JANGERMGSA-N |
| XLogP | 3.47 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |