C21H22BrNO4 — CID 20531267
methyl 4-[2-[[2-(5-bromo-1-benzofuran-2-yl)-2-hydroxyethyl]amino]propyl]benzoate (PubChem CID 20531267) has the molecular formula C21H22BrNO4 and a molecular weight of 432.31 g/mol. Its IUPAC name is methyl 4-[2-[[2-(5-bromo-1-benzofuran-2-yl)-2-hydroxyethyl]amino]propyl]benzoate.
| Compound Name | methyl 4-[2-[[2-(5-bromo-1-benzofuran-2-yl)-2-hydroxyethyl]amino]propyl]benzoate |
|---|---|
| PubChem CID | 20531267 |
| Molecular Formula | C21H22BrNO4 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | methyl 4-[2-[[2-(5-bromo-1-benzofuran-2-yl)-2-hydroxyethyl]amino]propyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(C)NCC(O)c2cc3cc(Br)ccc3o2)cc1 |
| InChI | InChI=1S/C21H22BrNO4/c1-13(9-14-3-5-15(6-4-14)21(25)26-2)23-12-18(24)20-11-16-10-17(22)7-8-19(16)27-20/h3-8,10-11,13,18,23-24H,9,12H2,1-2H3 |
| InChIKey | UPHASDJURSYKKQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |