C23H27NO4 — CID 70471814
methyl 3-[4-[2-[[2-(1-benzofuran-2-yl)-2-hydroxyethyl]amino]propyl]phenyl]propanoate (PubChem CID 70471814) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is methyl 3-[4-[2-[[2-(1-benzofuran-2-yl)-2-hydroxyethyl]amino]propyl]phenyl]propanoate.
| Compound Name | methyl 3-[4-[2-[[2-(1-benzofuran-2-yl)-2-hydroxyethyl]amino]propyl]phenyl]propanoate |
|---|---|
| PubChem CID | 70471814 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | methyl 3-[4-[2-[[2-(1-benzofuran-2-yl)-2-hydroxyethyl]amino]propyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(CC(C)NCC(O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-16(13-18-9-7-17(8-10-18)11-12-23(26)27-2)24-15-20(25)22-14-19-5-3-4-6-21(19)28-22/h3-10,14,16,20,24-25H,11-13,15H2,1-2H3 |
| InChIKey | HXOAEXIVHOHFFF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |