C18H18O3 — CID 65447175
1-(1-benzofuran-2-yl)-3-(4-methoxyphenyl)propan-1-ol (PubChem CID 65447175) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-3-(4-methoxyphenyl)propan-1-ol.
| Compound Name | 1-(1-benzofuran-2-yl)-3-(4-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 65447175 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-3-(4-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccc(CCC(O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C18H18O3/c1-20-15-9-6-13(7-10-15)8-11-16(19)18-12-14-4-2-3-5-17(14)21-18/h2-7,9-10,12,16,19H,8,11H2,1H3 |
| InChIKey | HFIMGOYJCKKJDN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |