C12H14O3 — CID 124681415
(1R)-1-(1-benzofuran-2-yl)butane-1,4-diol (PubChem CID 124681415) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1R)-1-(1-benzofuran-2-yl)butane-1,4-diol.
| Compound Name | (1R)-1-(1-benzofuran-2-yl)butane-1,4-diol |
|---|---|
| PubChem CID | 124681415 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (1R)-1-(1-benzofuran-2-yl)butane-1,4-diol |
| SMILES | OCCC[C@@H](O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C12H14O3/c13-7-3-5-10(14)12-8-9-4-1-2-6-11(9)15-12/h1-2,4,6,8,10,13-14H,3,5,7H2/t10-/m1/s1 |
| InChIKey | SKRDPZZCIUYBSF-SNVBAGLBSA-N |
| XLogP | 2.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |