C12H11F3O2 — CID 64566757
1-(1-benzofuran-2-yl)-4,4,4-trifluorobutan-1-ol (PubChem CID 64566757) has the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-4,4,4-trifluorobutan-1-ol.
| Compound Name | 1-(1-benzofuran-2-yl)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 64566757 |
| Molecular Formula | C12H11F3O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-4,4,4-trifluorobutan-1-ol |
| SMILES | OC(CCC(F)(F)F)c1cc2ccccc2o1 |
| InChI | InChI=1S/C12H11F3O2/c13-12(14,15)6-5-9(16)11-7-8-3-1-2-4-10(8)17-11/h1-4,7,9,16H,5-6H2 |
| InChIKey | BGDTVAITUHRPHD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |