C17H24O2 — CID 115836093
1-(1-benzofuran-2-yl)-3,5,5-trimethylhexan-1-ol (PubChem CID 115836093) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-3,5,5-trimethylhexan-1-ol.
| Compound Name | 1-(1-benzofuran-2-yl)-3,5,5-trimethylhexan-1-ol |
|---|---|
| PubChem CID | 115836093 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-3,5,5-trimethylhexan-1-ol |
| SMILES | CC(CC(O)c1cc2ccccc2o1)CC(C)(C)C |
| InChI | InChI=1S/C17H24O2/c1-12(11-17(2,3)4)9-14(18)16-10-13-7-5-6-8-15(13)19-16/h5-8,10,12,14,18H,9,11H2,1-4H3 |
| InChIKey | RWGGQOAJEYEXCS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |