C18H26O2 — CID 115836469
3,5,5-trimethyl-1-(7-methyl-1-benzofuran-2-yl)hexan-1-ol (PubChem CID 115836469) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 3,5,5-trimethyl-1-(7-methyl-1-benzofuran-2-yl)hexan-1-ol.
| Compound Name | 3,5,5-trimethyl-1-(7-methyl-1-benzofuran-2-yl)hexan-1-ol |
|---|---|
| PubChem CID | 115836469 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 3,5,5-trimethyl-1-(7-methyl-1-benzofuran-2-yl)hexan-1-ol |
| SMILES | Cc1cccc2cc(C(O)CC(C)CC(C)(C)C)oc12 |
| InChI | InChI=1S/C18H26O2/c1-12(11-18(3,4)5)9-15(19)16-10-14-8-6-7-13(2)17(14)20-16/h6-8,10,12,15,19H,9,11H2,1-5H3 |
| InChIKey | YEJXQLGIJYFSLH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |