C19H20O2 — CID 105129309
1-(7-methyl-1-benzofuran-2-yl)-4-phenylbutan-1-ol (PubChem CID 105129309) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(7-methyl-1-benzofuran-2-yl)-4-phenylbutan-1-ol.
| Compound Name | 1-(7-methyl-1-benzofuran-2-yl)-4-phenylbutan-1-ol |
|---|---|
| PubChem CID | 105129309 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-(7-methyl-1-benzofuran-2-yl)-4-phenylbutan-1-ol |
| SMILES | Cc1cccc2cc(C(O)CCCc3ccccc3)oc12 |
| InChI | InChI=1S/C19H20O2/c1-14-7-5-11-16-13-18(21-19(14)16)17(20)12-6-10-15-8-3-2-4-9-15/h2-5,7-9,11,13,17,20H,6,10,12H2,1H3 |
| InChIKey | UBXAEUFUPZDZAT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |