C14H16F2O3 — CID 103147842
3-(2,2-difluoroethoxy)-1-(7-methyl-1-benzofuran-2-yl)propan-1-ol (PubChem CID 103147842) has the molecular formula C14H16F2O3 and a molecular weight of 270.27 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(7-methyl-1-benzofuran-2-yl)propan-1-ol.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(7-methyl-1-benzofuran-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 103147842 |
| Molecular Formula | C14H16F2O3 |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(7-methyl-1-benzofuran-2-yl)propan-1-ol |
| SMILES | Cc1cccc2cc(C(O)CCOCC(F)F)oc12 |
| InChI | InChI=1S/C14H16F2O3/c1-9-3-2-4-10-7-12(19-14(9)10)11(17)5-6-18-8-13(15)16/h2-4,7,11,13,17H,5-6,8H2,1H3 |
| InChIKey | COZJRUDZVWJVND-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|