C14H15F3O2 — CID 105120593
5,5,5-trifluoro-1-(5-methyl-1-benzofuran-2-yl)pentan-1-ol (PubChem CID 105120593) has the molecular formula C14H15F3O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(5-methyl-1-benzofuran-2-yl)pentan-1-ol.
| Compound Name | 5,5,5-trifluoro-1-(5-methyl-1-benzofuran-2-yl)pentan-1-ol |
|---|---|
| PubChem CID | 105120593 |
| Molecular Formula | C14H15F3O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 5,5,5-trifluoro-1-(5-methyl-1-benzofuran-2-yl)pentan-1-ol |
| SMILES | Cc1ccc2oc(C(O)CCCC(F)(F)F)cc2c1 |
| InChI | InChI=1S/C14H15F3O2/c1-9-4-5-12-10(7-9)8-13(19-12)11(18)3-2-6-14(15,16)17/h4-5,7-8,11,18H,2-3,6H2,1H3 |
| InChIKey | WLWJPOZIJGWGQV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |