C19H20O2 — CID 114726442
2-(3,5-dimethylphenyl)-1-(5-methyl-1-benzofuran-2-yl)ethanol (PubChem CID 114726442) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-1-(5-methyl-1-benzofuran-2-yl)ethanol.
| Compound Name | 2-(3,5-dimethylphenyl)-1-(5-methyl-1-benzofuran-2-yl)ethanol |
|---|---|
| PubChem CID | 114726442 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-1-(5-methyl-1-benzofuran-2-yl)ethanol |
| SMILES | Cc1cc(C)cc(CC(O)c2cc3cc(C)ccc3o2)c1 |
| InChI | InChI=1S/C19H20O2/c1-12-4-5-18-16(9-12)11-19(21-18)17(20)10-15-7-13(2)6-14(3)8-15/h4-9,11,17,20H,10H2,1-3H3 |
| InChIKey | SAMNKKNGFJJXPL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |