C16H16O3 — CID 105129193
3-(furan-2-yl)-1-(5-methyl-1-benzofuran-2-yl)propan-1-ol (PubChem CID 105129193) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-(5-methyl-1-benzofuran-2-yl)propan-1-ol.
| Compound Name | 3-(furan-2-yl)-1-(5-methyl-1-benzofuran-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 105129193 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-(furan-2-yl)-1-(5-methyl-1-benzofuran-2-yl)propan-1-ol |
| SMILES | Cc1ccc2oc(C(O)CCc3ccco3)cc2c1 |
| InChI | InChI=1S/C16H16O3/c1-11-4-7-15-12(9-11)10-16(19-15)14(17)6-5-13-3-2-8-18-13/h2-4,7-10,14,17H,5-6H2,1H3 |
| InChIKey | JDSOVTKEYVWMNP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |