C18H17ClO2 — CID 105129392
1-(5-chloro-1-benzofuran-2-yl)-3-(4-methylphenyl)propan-1-ol (PubChem CID 105129392) has the molecular formula C18H17ClO2 and a molecular weight of 300.79 g/mol. Its IUPAC name is 1-(5-chloro-1-benzofuran-2-yl)-3-(4-methylphenyl)propan-1-ol.
| Compound Name | 1-(5-chloro-1-benzofuran-2-yl)-3-(4-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 105129392 |
| Molecular Formula | C18H17ClO2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(5-chloro-1-benzofuran-2-yl)-3-(4-methylphenyl)propan-1-ol |
| SMILES | Cc1ccc(CCC(O)c2cc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C18H17ClO2/c1-12-2-4-13(5-3-12)6-8-16(20)18-11-14-10-15(19)7-9-17(14)21-18/h2-5,7,9-11,16,20H,6,8H2,1H3 |
| InChIKey | GMVWFYVGJXVPEK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |