C14H17ClO3 — CID 105129366
1-(5-chloro-1-benzofuran-2-yl)-4-methoxypentan-1-ol (PubChem CID 105129366) has the molecular formula C14H17ClO3 and a molecular weight of 268.74 g/mol. Its IUPAC name is 1-(5-chloro-1-benzofuran-2-yl)-4-methoxypentan-1-ol.
| Compound Name | 1-(5-chloro-1-benzofuran-2-yl)-4-methoxypentan-1-ol |
|---|---|
| PubChem CID | 105129366 |
| Molecular Formula | C14H17ClO3 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-(5-chloro-1-benzofuran-2-yl)-4-methoxypentan-1-ol |
| SMILES | COC(C)CCC(O)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C14H17ClO3/c1-9(17-2)3-5-12(16)14-8-10-7-11(15)4-6-13(10)18-14/h4,6-9,12,16H,3,5H2,1-2H3 |
| InChIKey | KDTLODXTFZEXIT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |