C22H27NO3 — CID 54381309
methyl 3-[4-[2-[(2-hydroxy-2-phenylethyl)amino]propyl]phenyl]but-2-enoate (PubChem CID 54381309) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is methyl 3-[4-[2-[(2-hydroxy-2-phenylethyl)amino]propyl]phenyl]but-2-enoate.
| Compound Name | methyl 3-[4-[2-[(2-hydroxy-2-phenylethyl)amino]propyl]phenyl]but-2-enoate |
|---|---|
| PubChem CID | 54381309 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | methyl 3-[4-[2-[(2-hydroxy-2-phenylethyl)amino]propyl]phenyl]but-2-enoate |
| SMILES | COC(=O)C=C(C)c1ccc(CC(C)NCC(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H27NO3/c1-16(13-22(25)26-3)19-11-9-18(10-12-19)14-17(2)23-15-21(24)20-7-5-4-6-8-20/h4-13,17,21,23-24H,14-15H2,1-3H3 |
| InChIKey | VACCBQNBJAQENC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|