C31H37NO6 — CID 70571201
methyl 4-[3-[(2-hydroxy-2-phenylethyl)amino]butyl]benzoate;4-(3-oxobutyl)benzoic acid (PubChem CID 70571201) has the molecular formula C31H37NO6 and a molecular weight of 519.64 g/mol. Its IUPAC name is methyl 4-[3-[(2-hydroxy-2-phenylethyl)amino]butyl]benzoate;4-(3-oxobutyl)benzoic acid.
| Compound Name | methyl 4-[3-[(2-hydroxy-2-phenylethyl)amino]butyl]benzoate;4-(3-oxobutyl)benzoic acid |
|---|---|
| PubChem CID | 70571201 |
| Molecular Formula | C31H37NO6 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | methyl 4-[3-[(2-hydroxy-2-phenylethyl)amino]butyl]benzoate;4-(3-oxobutyl)benzoic acid |
| SMILES | CC(=O)CCc1ccc(C(=O)O)cc1.COC(=O)c1ccc(CCC(C)NCC(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO3.C11H12O3/c1-15(21-14-19(22)17-6-4-3-5-7-17)8-9-16-10-12-18(13-11-16)20(23)24-2;1-8(12)2-3-9-4-6-10(7-5-9)11(13)14/h3-7,10-13,15,19,21-22H,8-9,14H2,1-2H3;4-7H,2-3H2,1H3,(H,13,14) |
| InChIKey | IPUFYVNCCXYZLN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |