C21H28N2O2 — CID 70429456
4-[3-[[(2R)-2-hydroxy-2-phenylethyl]amino]butyl]-N,N-dimethylbenzamide (PubChem CID 70429456) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-[3-[[(2R)-2-hydroxy-2-phenylethyl]amino]butyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-[[(2R)-2-hydroxy-2-phenylethyl]amino]butyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 70429456 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 4-[3-[[(2R)-2-hydroxy-2-phenylethyl]amino]butyl]-N,N-dimethylbenzamide |
| SMILES | CC(CCc1ccc(C(=O)N(C)C)cc1)NC[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O2/c1-16(22-15-20(24)18-7-5-4-6-8-18)9-10-17-11-13-19(14-12-17)21(25)23(2)3/h4-8,11-14,16,20,22,24H,9-10,15H2,1-3H3/t16?,20-/m0/s1 |
| InChIKey | HKCLGFABRUIFAW-FZCLLLDFSA-N |
| XLogP | 3.03 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |