C19H26ClNO3S — CID 70469832
(1R)-2-[[(2S)-4-(4-methylsulfonylphenyl)butan-2-yl]amino]-1-phenylethanol;hydrochloride (PubChem CID 70469832) has the molecular formula C19H26ClNO3S and a molecular weight of 383.94 g/mol. Its IUPAC name is (1R)-2-[[(2S)-4-(4-methylsulfonylphenyl)butan-2-yl]amino]-1-phenylethanol;hydrochloride.
| Compound Name | (1R)-2-[[(2S)-4-(4-methylsulfonylphenyl)butan-2-yl]amino]-1-phenylethanol;hydrochloride |
|---|---|
| PubChem CID | 70469832 |
| Molecular Formula | C19H26ClNO3S |
| Molecular Weight | 383.94 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (1R)-2-[[(2S)-4-(4-methylsulfonylphenyl)butan-2-yl]amino]-1-phenylethanol;hydrochloride |
| SMILES | C[C@@H](CCc1ccc(S(C)(=O)=O)cc1)NC[C@H](O)c1ccccc1.Cl |
| InChI | InChI=1S/C19H25NO3S.ClH/c1-15(20-14-19(21)17-6-4-3-5-7-17)8-9-16-10-12-18(13-11-16)24(2,22)23;/h3-7,10-13,15,19-21H,8-9,14H2,1-2H3;1H/t15-,19-;/m0./s1 |
| InChIKey | BOSPURJZGKDGMJ-GIDGLZBFSA-N |
| XLogP | 3.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.94 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |