C15H25NO3S — CID 62200407
2-(hexan-2-ylamino)-1-(4-methylsulfonylphenyl)ethanol (PubChem CID 62200407) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-(hexan-2-ylamino)-1-(4-methylsulfonylphenyl)ethanol.
| Compound Name | 2-(hexan-2-ylamino)-1-(4-methylsulfonylphenyl)ethanol |
|---|---|
| PubChem CID | 62200407 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-(hexan-2-ylamino)-1-(4-methylsulfonylphenyl)ethanol |
| SMILES | CCCCC(C)NCC(O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H25NO3S/c1-4-5-6-12(2)16-11-15(17)13-7-9-14(10-8-13)20(3,18)19/h7-10,12,15-17H,4-6,11H2,1-3H3 |
| InChIKey | GJEGCKQXPYBQQC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |