C20H26ClNO3 — CID 70590910
[4-[(3R)-3-[[(2R)-2-hydroxy-2-phenylethyl]amino]butyl]phenyl] acetate;hydrochloride (PubChem CID 70590910) has the molecular formula C20H26ClNO3 and a molecular weight of 363.89 g/mol. Its IUPAC name is [4-[(3R)-3-[[(2R)-2-hydroxy-2-phenylethyl]amino]butyl]phenyl] acetate;hydrochloride.
| Compound Name | [4-[(3R)-3-[[(2R)-2-hydroxy-2-phenylethyl]amino]butyl]phenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 70590910 |
| Molecular Formula | C20H26ClNO3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [4-[(3R)-3-[[(2R)-2-hydroxy-2-phenylethyl]amino]butyl]phenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1ccc(CC[C@@H](C)NC[C@H](O)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H25NO3.ClH/c1-15(21-14-20(23)18-6-4-3-5-7-18)8-9-17-10-12-19(13-11-17)24-16(2)22;/h3-7,10-13,15,20-21,23H,8-9,14H2,1-2H3;1H/t15-,20+;/m1./s1 |
| InChIKey | JEOIWRNBMXAPGR-SWFRRQLPSA-N |
| XLogP | 3.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|