C18H22N2O3 — CID 547333
1-(3-nitrophenyl)-2-(4-phenylbutan-2-ylamino)ethanol (PubChem CID 547333) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-2-(4-phenylbutan-2-ylamino)ethanol.
| Compound Name | 1-(3-nitrophenyl)-2-(4-phenylbutan-2-ylamino)ethanol |
|---|---|
| PubChem CID | 547333 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-(3-nitrophenyl)-2-(4-phenylbutan-2-ylamino)ethanol |
| SMILES | CC(CCc1ccccc1)NCC(O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H22N2O3/c1-14(10-11-15-6-3-2-4-7-15)19-13-18(21)16-8-5-9-17(12-16)20(22)23/h2-9,12,14,18-19,21H,10-11,13H2,1H3 |
| InChIKey | OYQXFOCKMWBHCC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|