C19H24ClNO — CID 23322179
1-(3-chlorophenyl)-2-[4-(4-methylphenyl)butan-2-ylamino]ethanol (PubChem CID 23322179) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[4-(4-methylphenyl)butan-2-ylamino]ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-[4-(4-methylphenyl)butan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 23322179 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[4-(4-methylphenyl)butan-2-ylamino]ethanol |
| SMILES | Cc1ccc(CCC(C)NCC(O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H24ClNO/c1-14-6-9-16(10-7-14)11-8-15(2)21-13-19(22)17-4-3-5-18(20)12-17/h3-7,9-10,12,15,19,21-22H,8,11,13H2,1-2H3 |
| InChIKey | SEOSMLFDCARSPA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |