C20H26ClNO3 — CID 18996354
1-(3-chlorophenyl)-2-[4-(3,4-dimethoxyphenyl)butan-2-ylamino]ethanol (PubChem CID 18996354) has the molecular formula C20H26ClNO3 and a molecular weight of 363.89 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[4-(3,4-dimethoxyphenyl)butan-2-ylamino]ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-[4-(3,4-dimethoxyphenyl)butan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 18996354 |
| Molecular Formula | C20H26ClNO3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[4-(3,4-dimethoxyphenyl)butan-2-ylamino]ethanol |
| SMILES | COc1ccc(CCC(C)NCC(O)c2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C20H26ClNO3/c1-14(22-13-18(23)16-5-4-6-17(21)12-16)7-8-15-9-10-19(24-2)20(11-15)25-3/h4-6,9-12,14,18,22-23H,7-8,13H2,1-3H3 |
| InChIKey | YEWNSVPPFUHJLU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |