C12H16ClNO3 — CID 139647161
methyl (2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propanoate (PubChem CID 139647161) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is methyl (2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propanoate |
|---|---|
| PubChem CID | 139647161 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | methyl (2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NC[C@H](O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO3/c1-8(12(16)17-2)14-7-11(15)9-4-3-5-10(13)6-9/h3-6,8,11,14-15H,7H2,1-2H3/t8-,11+/m1/s1 |
| InChIKey | HTFQHZDYMBMHNJ-KCJUWKMLSA-N |
| XLogP | 1.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |