C23H30ClNO4 — CID 139655941
methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]pentanoate (PubChem CID 139655941) has the molecular formula C23H30ClNO4 and a molecular weight of 419.95 g/mol. Its IUPAC name is methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]pentanoate.
| Compound Name | methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 139655941 |
| Molecular Formula | C23H30ClNO4 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]pentanoate |
| SMILES | CCCC(Oc1ccc(CC(C)NCC(O)c2cccc(Cl)c2)cc1)C(=O)OC |
| InChI | InChI=1S/C23H30ClNO4/c1-4-6-22(23(27)28-3)29-20-11-9-17(10-12-20)13-16(2)25-15-21(26)18-7-5-8-19(24)14-18/h5,7-12,14,16,21-22,25-26H,4,6,13,15H2,1-3H3 |
| InChIKey | HPYVWUVKBYQZED-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |