C22H28ClNO4 — CID 70479804
methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-methoxyethyl]amino]propyl]phenoxy]propanoate (PubChem CID 70479804) has the molecular formula C22H28ClNO4 and a molecular weight of 405.92 g/mol. Its IUPAC name is methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-methoxyethyl]amino]propyl]phenoxy]propanoate.
| Compound Name | methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-methoxyethyl]amino]propyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 70479804 |
| Molecular Formula | C22H28ClNO4 |
| Molecular Weight | 405.92 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-methoxyethyl]amino]propyl]phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1ccc(CC(C)NCC(OC)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H28ClNO4/c1-15(24-14-21(26-3)18-6-5-7-19(23)13-18)12-17-8-10-20(11-9-17)28-16(2)22(25)27-4/h5-11,13,15-16,21,24H,12,14H2,1-4H3 |
| InChIKey | HVSLVBODNBCWMB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |