C26H36ClNO4 — CID 54032734
methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hexoxyethyl]amino]propyl]phenoxy]acetate (PubChem CID 54032734) has the molecular formula C26H36ClNO4 and a molecular weight of 462.03 g/mol. Its IUPAC name is methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hexoxyethyl]amino]propyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hexoxyethyl]amino]propyl]phenoxy]acetate |
|---|---|
| PubChem CID | 54032734 |
| Molecular Formula | C26H36ClNO4 |
| Molecular Weight | 462.03 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | methyl 2-[4-[2-[[2-(3-chlorophenyl)-2-hexoxyethyl]amino]propyl]phenoxy]acetate |
| SMILES | CCCCCCOC(CNC(C)Cc1ccc(OCC(=O)OC)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H36ClNO4/c1-4-5-6-7-15-31-25(22-9-8-10-23(27)17-22)18-28-20(2)16-21-11-13-24(14-12-21)32-19-26(29)30-3/h8-14,17,20,25,28H,4-7,15-16,18-19H2,1-3H3 |
| InChIKey | LGTKGXJFYGZCJQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.03 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|