C20H24ClNO3 — CID 54061917
methyl 2-[4-[2-[2-(3-chlorophenyl)ethylamino]propyl]phenoxy]acetate (PubChem CID 54061917) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is methyl 2-[4-[2-[2-(3-chlorophenyl)ethylamino]propyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[2-[2-(3-chlorophenyl)ethylamino]propyl]phenoxy]acetate |
|---|---|
| PubChem CID | 54061917 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | methyl 2-[4-[2-[2-(3-chlorophenyl)ethylamino]propyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(CC(C)NCCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H24ClNO3/c1-15(22-11-10-16-4-3-5-18(21)13-16)12-17-6-8-19(9-7-17)25-14-20(23)24-2/h3-9,13,15,22H,10-12,14H2,1-2H3 |
| InChIKey | MAHYTHJMETZQTM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |