C23H28F3NO5 — CID 88670825
methyl 2-[4-[2-[[2-(2-hydroxyethoxy)-2-(2,4,5-trifluoro-3-methylphenyl)ethyl]amino]propyl]phenoxy]acetate (PubChem CID 88670825) has the molecular formula C23H28F3NO5 and a molecular weight of 455.47 g/mol. Its IUPAC name is methyl 2-[4-[2-[[2-(2-hydroxyethoxy)-2-(2,4,5-trifluoro-3-methylphenyl)ethyl]amino]propyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[2-[[2-(2-hydroxyethoxy)-2-(2,4,5-trifluoro-3-methylphenyl)ethyl]amino]propyl]phenoxy]acetate |
|---|---|
| PubChem CID | 88670825 |
| Molecular Formula | C23H28F3NO5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | methyl 2-[4-[2-[[2-(2-hydroxyethoxy)-2-(2,4,5-trifluoro-3-methylphenyl)ethyl]amino]propyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(CC(C)NCC(OCCO)c2cc(F)c(F)c(C)c2F)cc1 |
| InChI | InChI=1S/C23H28F3NO5/c1-14(10-16-4-6-17(7-5-16)32-13-21(29)30-3)27-12-20(31-9-8-28)18-11-19(24)23(26)15(2)22(18)25/h4-7,11,14,20,27-28H,8-10,12-13H2,1-3H3 |
| InChIKey | IRHGYSJCRLKPMQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|