C20H26ClNO4 — CID 70472638
2-amino-1-(3-chlorophenyl)ethanol;methyl 2-(4-propylphenoxy)acetate (PubChem CID 70472638) has the molecular formula C20H26ClNO4 and a molecular weight of 379.88 g/mol. Its IUPAC name is 2-amino-1-(3-chlorophenyl)ethanol;methyl 2-(4-propylphenoxy)acetate.
| Compound Name | 2-amino-1-(3-chlorophenyl)ethanol;methyl 2-(4-propylphenoxy)acetate |
|---|---|
| PubChem CID | 70472638 |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-amino-1-(3-chlorophenyl)ethanol;methyl 2-(4-propylphenoxy)acetate |
| SMILES | CCCc1ccc(OCC(=O)OC)cc1.NCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H16O3.C8H10ClNO/c1-3-4-10-5-7-11(8-6-10)15-9-12(13)14-2;9-7-3-1-2-6(4-7)8(11)5-10/h5-8H,3-4,9H2,1-2H3;1-4,8,11H,5,10H2 |
| InChIKey | PICYASBLTLBBAZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |