C9H12ClNO4 — CID 67865938
2-amino-1-(3-chlorophenyl)ethanol;carbonic acid (PubChem CID 67865938) has the molecular formula C9H12ClNO4 and a molecular weight of 233.65 g/mol. Its IUPAC name is 2-amino-1-(3-chlorophenyl)ethanol;carbonic acid.
| Compound Name | 2-amino-1-(3-chlorophenyl)ethanol;carbonic acid |
|---|---|
| PubChem CID | 67865938 |
| Molecular Formula | C9H12ClNO4 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-amino-1-(3-chlorophenyl)ethanol;carbonic acid |
| SMILES | NCC(O)c1cccc(Cl)c1.O=C(O)O |
| InChI | InChI=1S/C8H10ClNO.CH2O3/c9-7-3-1-2-6(4-7)8(11)5-10;2-1(3)4/h1-4,8,11H,5,10H2;(H2,2,3,4) |
| InChIKey | CTQQHQXOLGWMGY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |