C17H19ClN2O3 — CID 69052441
2-(4-aminophenyl)ethyl-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamic acid (PubChem CID 69052441) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 2-(4-aminophenyl)ethyl-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamic acid.
| Compound Name | 2-(4-aminophenyl)ethyl-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamic acid |
|---|---|
| PubChem CID | 69052441 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(4-aminophenyl)ethyl-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamic acid |
| SMILES | Nc1ccc(CCN(C[C@@H](O)c2cccc(Cl)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C17H19ClN2O3/c18-14-3-1-2-13(10-14)16(21)11-20(17(22)23)9-8-12-4-6-15(19)7-5-12/h1-7,10,16,21H,8-9,11,19H2,(H,22,23)/t16-/m1/s1 |
| InChIKey | AAYQZEOLIVZBNX-MRXNPFEDSA-N |
| XLogP | 3.18 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|