C26H26ClNO4 — CID 87673747
[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-[2-[4-(4-formyl-2,3-dimethylphenyl)phenyl]ethyl]carbamic acid (PubChem CID 87673747) has the molecular formula C26H26ClNO4 and a molecular weight of 451.95 g/mol. Its IUPAC name is [(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-[2-[4-(4-formyl-2,3-dimethylphenyl)phenyl]ethyl]carbamic acid.
| Compound Name | [(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-[2-[4-(4-formyl-2,3-dimethylphenyl)phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 87673747 |
| Molecular Formula | C26H26ClNO4 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-[2-[4-(4-formyl-2,3-dimethylphenyl)phenyl]ethyl]carbamic acid |
| SMILES | Cc1c(C=O)ccc(-c2ccc(CCN(C[C@H](O)c3cccc(Cl)c3)C(=O)O)cc2)c1C |
| InChI | InChI=1S/C26H26ClNO4/c1-17-18(2)24(11-10-22(17)16-29)20-8-6-19(7-9-20)12-13-28(26(31)32)15-25(30)21-4-3-5-23(27)14-21/h3-11,14,16,25,30H,12-13,15H2,1-2H3,(H,31,32)/t25-/m0/s1 |
| InChIKey | QRDHMYDKZIMAMJ-VWLOTQADSA-N |
| XLogP | 5.69 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|