C23H23BrClNO — CID 24822638
(1R)-2-[benzyl-[2-(4-bromophenyl)ethyl]amino]-1-(3-chlorophenyl)ethanol (PubChem CID 24822638) has the molecular formula C23H23BrClNO and a molecular weight of 444.80 g/mol. Its IUPAC name is (1R)-2-[benzyl-[2-(4-bromophenyl)ethyl]amino]-1-(3-chlorophenyl)ethanol.
| Compound Name | (1R)-2-[benzyl-[2-(4-bromophenyl)ethyl]amino]-1-(3-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 24822638 |
| Molecular Formula | C23H23BrClNO |
| Molecular Weight | 444.80 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | (1R)-2-[benzyl-[2-(4-bromophenyl)ethyl]amino]-1-(3-chlorophenyl)ethanol |
| SMILES | O[C@@H](CN(CCc1ccc(Br)cc1)Cc1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H23BrClNO/c24-21-11-9-18(10-12-21)13-14-26(16-19-5-2-1-3-6-19)17-23(27)20-7-4-8-22(25)15-20/h1-12,15,23,27H,13-14,16-17H2/t23-/m0/s1 |
| InChIKey | ZVUJQLOULPIDID-QHCPKHFHSA-N |
| XLogP | 5.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.80 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |