C24H25Br2NO3 — CID 54261820
4-[2-[bis[2-(3-bromophenyl)-2-hydroxyethyl]amino]ethyl]phenol (PubChem CID 54261820) has the molecular formula C24H25Br2NO3 and a molecular weight of 535.28 g/mol. Its IUPAC name is 4-[2-[bis[2-(3-bromophenyl)-2-hydroxyethyl]amino]ethyl]phenol.
| Compound Name | 4-[2-[bis[2-(3-bromophenyl)-2-hydroxyethyl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 54261820 |
| Molecular Formula | C24H25Br2NO3 |
| Molecular Weight | 535.28 g/mol |
| Exact Mass | 533.02 |
| IUPAC Name | 4-[2-[bis[2-(3-bromophenyl)-2-hydroxyethyl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCN(CC(O)c2cccc(Br)c2)CC(O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C24H25Br2NO3/c25-20-5-1-3-18(13-20)23(29)15-27(12-11-17-7-9-22(28)10-8-17)16-24(30)19-4-2-6-21(26)14-19/h1-10,13-14,23-24,28-30H,11-12,15-16H2 |
| InChIKey | REBBIHQAPUIWRM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.28 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |