C17H19Br2NO — CID 63489449
1-(3-bromophenyl)-3-[(4-bromophenyl)methyl-methylamino]propan-1-ol (PubChem CID 63489449) has the molecular formula C17H19Br2NO and a molecular weight of 413.15 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[(4-bromophenyl)methyl-methylamino]propan-1-ol.
| Compound Name | 1-(3-bromophenyl)-3-[(4-bromophenyl)methyl-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 63489449 |
| Molecular Formula | C17H19Br2NO |
| Molecular Weight | 413.15 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | 1-(3-bromophenyl)-3-[(4-bromophenyl)methyl-methylamino]propan-1-ol |
| SMILES | CN(CCC(O)c1cccc(Br)c1)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H19Br2NO/c1-20(12-13-5-7-15(18)8-6-13)10-9-17(21)14-3-2-4-16(19)11-14/h2-8,11,17,21H,9-10,12H2,1H3 |
| InChIKey | ZWJGAAZNCALPRR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.15 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |